CAS 1178634-57-5 appears in our catalog under these names: Propyl 2-amino-5-bromobenzoate, Propyl 2-amino-5-bromobenzoate, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 2,5g, 250mg, 5g.
Propyl 2-amino-5-bromobenzoate (CAS 1178634-57-5) is a chemical compound with the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. IUPAC name: propyl 2-amino-5-bromobenzoate. InChIKey: RZNWHBKKKOQGIW-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2 |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | propyl 2-amino-5-bromobenzoate |
| InChIKey | RZNWHBKKKOQGIW-UHFFFAOYSA-N |
| SMILES | CCCOC(=O)C1=C(C=CC(=C1)Br)N |
Computed by PubChem (NCBI)