Products 1179360-30-5
CAS 1179360-30-5 is the registry number for 6-Bromo-7-methylisobenzofuran-1(3H)-one, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
6-bromo-7-methyl-3H-2-benzofuran-1-one (CAS 1179360-30-5) is a chemical compound with the molecular formula C9H7BrO2 and a molecular weight of 227.05 g/mol. IUPAC name: 6-bromo-7-methyl-3H-2-benzofuran-1-one. InChIKey: XCTQJVHBGWKGKS-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO2 |
|---|---|
| Molecular weight | 227.05 g/mol |
| IUPAC name | 6-bromo-7-methyl-3H-2-benzofuran-1-one |
| InChIKey | XCTQJVHBGWKGKS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1C(=O)OC2)Br |
Computed by PubChem (NCBI)