Products 1179361-81-9
CAS 1179361-81-9 is the registry number for 6-Chloro-7-fluoro-2,3-dihydro-1H-inden-1-one. Offered by: Biosynth. Available pack sizes: 1g.
6-chloro-7-fluoro-2,3-dihydroinden-1-one (CAS 1179361-81-9) is a chemical compound with the molecular formula C9H6ClFO and a molecular weight of 184.59 g/mol. IUPAC name: 6-chloro-7-fluoro-2,3-dihydroinden-1-one. InChIKey: DWOJVTYJLHIUFI-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFO |
|---|---|
| Molecular weight | 184.59 g/mol |
| IUPAC name | 6-chloro-7-fluoro-2,3-dihydroinden-1-one |
| InChIKey | DWOJVTYJLHIUFI-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C=CC(=C2F)Cl |
Computed by PubChem (NCBI)