Products 1179703-95-7
CAS 1179703-95-7 appears in our catalog under these names: 3-{((3-cyanopyridin-2-yl)amino)methyl}benzoic acid, 95%, 3-{((3-Cyanopyridin-2-yl)amino)methyl}benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-[[(3-cyano-2-pyridinyl)amino]methyl]benzoic acid (CAS 1179703-95-7) is a chemical compound with the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. IUPAC name: 3-[[(3-cyano-2-pyridinyl)amino]methyl]benzoic acid. InChIKey: WYUQZODHMPUTKJ-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O2 |
|---|---|
| Molecular weight | 253.26 g/mol |
| IUPAC name | 3-[[(3-cyano-2-pyridinyl)amino]methyl]benzoic acid |
| InChIKey | WYUQZODHMPUTKJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)CNC2=C(C=CC=N2)C#N |
Computed by PubChem (NCBI)