Products 117979-53-0

CAS 117979-53-0 is the registry number for 2-(Benzoylamino)-3-hydroxybenzoic acid. Offered by: Biosynth. Available pack sizes: 25mg, 50mg, 100mg, 250mg.

Structural formula: {0} (CAS {1})

2-benzamido-3-hydroxybenzoic acid (CAS 117979-53-0) is a chemical compound with the molecular formula C14H11NO4 and a molecular weight of 257.24 g/mol. IUPAC name: 2-benzamido-3-hydroxybenzoic acid. InChIKey: NLIPIHFHWJQJJR-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11NO4
Molecular weight257.24 g/mol
IUPAC name2-benzamido-3-hydroxybenzoic acid
InChIKeyNLIPIHFHWJQJJR-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(=O)NC2=C(C=CC=C2O)C(=O)O

Computed by PubChem (NCBI)