CAS 1179961-64-8 is the registry number for N-(2-(Thiophen-2-yl)ethyl)benzo[d]oxazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2-thiophen-2-ylethyl)-1,3-benzoxazol-2-amine (CAS 1179961-64-8) is a chemical compound with the molecular formula C13H12N2OS and a molecular weight of 244.31 g/mol. IUPAC name: N-(2-thiophen-2-ylethyl)-1,3-benzoxazol-2-amine. InChIKey: RFNPSMDRLYNDGG-UHFFFAOYSA-N.
| Molecular formula | C13H12N2OS |
|---|---|
| Molecular weight | 244.31 g/mol |
| IUPAC name | N-(2-thiophen-2-ylethyl)-1,3-benzoxazol-2-amine |
| InChIKey | RFNPSMDRLYNDGG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(O2)NCCC3=CC=CS3 |
Computed by PubChem (NCBI)