CAS 20496-10-0 is the registry number for 1-(4-Phenylthiazol-2-yl)pyrrolidin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-phenyl-1,3-thiazol-2-yl)pyrrolidin-2-one (CAS 20496-10-0) is a chemical compound with the molecular formula C13H12N2OS and a molecular weight of 244.31 g/mol. IUPAC name: 1-(4-phenyl-1,3-thiazol-2-yl)pyrrolidin-2-one. InChIKey: FKVUYEBROQKEAR-UHFFFAOYSA-N.
| Molecular formula | C13H12N2OS |
|---|---|
| Molecular weight | 244.31 g/mol |
| IUPAC name | 1-(4-phenyl-1,3-thiazol-2-yl)pyrrolidin-2-one |
| InChIKey | FKVUYEBROQKEAR-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1)C2=NC(=CS2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)