CAS 617688-39-8 is the registry number for 2-Amino-4,5-dihydronaphtho[1,2-b]thiophene-3-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 10g, 5g.
2-amino-4,5-dihydrobenzo[g][1]benzothiole-3-carboxamide (CAS 617688-39-8) is a chemical compound with the molecular formula C13H12N2OS and a molecular weight of 244.31 g/mol. IUPAC name: 2-amino-4,5-dihydrobenzo[g][1]benzothiole-3-carboxamide. InChIKey: AAQADBFOLFOIOA-UHFFFAOYSA-N.
| Molecular formula | C13H12N2OS |
|---|---|
| Molecular weight | 244.31 g/mol |
| IUPAC name | 2-amino-4,5-dihydrobenzo[g][1]benzothiole-3-carboxamide |
| InChIKey | AAQADBFOLFOIOA-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C3=CC=CC=C31)SC(=C2C(=O)N)N |
Computed by PubChem (NCBI)