CAS 1183801-78-6 is the registry number for N-(2-(Furan-2-yl)ethyl)benzo[d]thiazol-2-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[2-(furan-2-yl)ethyl]-1,3-benzothiazol-2-amine (CAS 1183801-78-6) is a chemical compound with the molecular formula C13H12N2OS and a molecular weight of 244.31 g/mol. IUPAC name: N-[2-(furan-2-yl)ethyl]-1,3-benzothiazol-2-amine. InChIKey: JEPBQETXLSLYIL-UHFFFAOYSA-N.
| Molecular formula | C13H12N2OS |
|---|---|
| Molecular weight | 244.31 g/mol |
| IUPAC name | N-[2-(furan-2-yl)ethyl]-1,3-benzothiazol-2-amine |
| InChIKey | JEPBQETXLSLYIL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)NCCC3=CC=CO3 |
Computed by PubChem (NCBI)