CAS 1803582-68-4 is the registry number for 3-(Pyridine-3-carbonyl)-4H,5H,6H-cyclopenta(b)thiophen-2-amine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(2-amino-5,6-dihydro-4H-cyclopenta[b]thiophen-3-yl)-pyridin-3-ylmethanone (CAS 1803582-68-4) is a chemical compound with the molecular formula C13H12N2OS and a molecular weight of 244.31 g/mol. IUPAC name: (2-amino-5,6-dihydro-4H-cyclopenta[b]thiophen-3-yl)-pyridin-3-ylmethanone. InChIKey: VDVWIZPBTMVTDY-UHFFFAOYSA-N.
| Molecular formula | C13H12N2OS |
|---|---|
| Molecular weight | 244.31 g/mol |
| IUPAC name | (2-amino-5,6-dihydro-4H-cyclopenta[b]thiophen-3-yl)-pyridin-3-ylmethanone |
| InChIKey | VDVWIZPBTMVTDY-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)SC(=C2C(=O)C3=CN=CC=C3)N |
Computed by PubChem (NCBI)