CAS 118-04-7 appears in our catalog under these names: Chlortalidone Impurity 4, 2-(3-Amino-4-chlorobenzoyl)benzoic Acid), 2-(3-Amino-4-chlorobenzoyl)benzoic acid 97%, 2-(3-Amino-4-chlorobenzoyl)benzoic acid, 97%, 97%, 2-(3-Amino-4-chlorobenzoyl)benzoic acid, 97%. Offered by: Chemat Brand, TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 2,5g, 25g, 5g, 10g, 100g, 500g.
2-(3-amino-4-chlorobenzoyl)benzoic acid (CAS 118-04-7) is a chemical compound with the molecular formula C14H10ClNO3 and a molecular weight of 275.68 g/mol. IUPAC name: 2-(3-amino-4-chlorobenzoyl)benzoic acid. InChIKey: MQECGSWGDQIHHD-UHFFFAOYSA-N.
| Molecular formula | C14H10ClNO3 |
|---|---|
| Molecular weight | 275.68 g/mol |
| IUPAC name | 2-(3-amino-4-chlorobenzoyl)benzoic acid |
| InChIKey | MQECGSWGDQIHHD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC(=C(C=C2)Cl)N)C(=O)O |
Computed by PubChem (NCBI)