Products 1797131-66-8
CAS 1797131-66-8 is the registry number for 2-Chloro-8-methoxy-dibenz(b,f)(1,4)oxazepin-11(10H)-one, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 1g.
8-chloro-3-methoxy-5H-benzo[b][1,4]benzoxazepin-6-one (CAS 1797131-66-8) is a chemical compound with the molecular formula C14H10ClNO3 and a molecular weight of 275.68 g/mol. IUPAC name: 8-chloro-3-methoxy-5H-benzo[b][1,4]benzoxazepin-6-one. InChIKey: BVFXAMGBKDTXTL-UHFFFAOYSA-N.
| Molecular formula | C14H10ClNO3 |
|---|---|
| Molecular weight | 275.68 g/mol |
| IUPAC name | 8-chloro-3-methoxy-5H-benzo[b][1,4]benzoxazepin-6-one |
| InChIKey | BVFXAMGBKDTXTL-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)OC3=C(C=C(C=C3)Cl)C(=O)N2 |
Computed by PubChem (NCBI)