CAS 40306-24-9 is the registry number for 4-Chloro-4'-methyl-3-nitrobenzophenone. Offered by: TRC. Available pack sizes: 100g, 25g.
(4-chloro-3-nitrophenyl)-(4-methylphenyl)methanone (CAS 40306-24-9) is a chemical compound with the molecular formula C14H10ClNO3 and a molecular weight of 275.68 g/mol. IUPAC name: (4-chloro-3-nitrophenyl)-(4-methylphenyl)methanone. InChIKey: ZRCRGBZPAADXJT-UHFFFAOYSA-N.
| Molecular formula | C14H10ClNO3 |
|---|---|
| Molecular weight | 275.68 g/mol |
| IUPAC name | (4-chloro-3-nitrophenyl)-(4-methylphenyl)methanone |
| InChIKey | ZRCRGBZPAADXJT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)