CAS 35485-71-3 is the registry number for (2-Chloro-5-nitrophenyl)(4-methylphenyl)methanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(2-chloro-5-nitrophenyl)-(4-methylphenyl)methanone (CAS 35485-71-3) is a chemical compound with the molecular formula C14H10ClNO3 and a molecular weight of 275.68 g/mol. IUPAC name: (2-chloro-5-nitrophenyl)-(4-methylphenyl)methanone. InChIKey: YAHRMDKLABSJKX-UHFFFAOYSA-N.
| Molecular formula | C14H10ClNO3 |
|---|---|
| Molecular weight | 275.68 g/mol |
| IUPAC name | (2-chloro-5-nitrophenyl)-(4-methylphenyl)methanone |
| InChIKey | YAHRMDKLABSJKX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C2=C(C=CC(=C2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)