CAS 676494-59-0 is the registry number for 3-chloro-4-(4-formylphenoxy)benzamide, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
3-chloro-4-(4-formylphenoxy)benzamide (CAS 676494-59-0) is a chemical compound with the molecular formula C14H10ClNO3 and a molecular weight of 275.68 g/mol. IUPAC name: 3-chloro-4-(4-formylphenoxy)benzamide. InChIKey: VRGOIKATLALCJJ-UHFFFAOYSA-N.
| Molecular formula | C14H10ClNO3 |
|---|---|
| Molecular weight | 275.68 g/mol |
| IUPAC name | 3-chloro-4-(4-formylphenoxy)benzamide |
| InChIKey | VRGOIKATLALCJJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)OC2=C(C=C(C=C2)C(=O)N)Cl |
Computed by PubChem (NCBI)