CAS 118080-77-6 is the registry number for 2,7-Diaza-1,2,3,6,7,8-hexahydropyrene. Offered by: TRC. Available pack sizes: 500mg.
6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene (CAS 118080-77-6) is a chemical compound with the molecular formula C14H14N2 and a molecular weight of 210.27 g/mol. IUPAC name: 6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene. InChIKey: HITIEOYNGDBUDI-UHFFFAOYSA-N.
| Molecular formula | C14H14N2 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | 6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene |
| InChIKey | HITIEOYNGDBUDI-UHFFFAOYSA-N |
| SMILES | C1C2=C3C(=CC=C4C3=C(CNC4)C=C2)CN1 |
Computed by PubChem (NCBI)