Products 1181321-00-5

CAS 1181321-00-5 is the registry number for 3'-Chloro-2'-methylbiphenyl-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-(3-chloro-2-methylphenyl)benzoic acid (CAS 1181321-00-5) is a chemical compound with the molecular formula C14H11ClO2 and a molecular weight of 246.69 g/mol. IUPAC name: 3-(3-chloro-2-methylphenyl)benzoic acid. InChIKey: WATQOCAYEWBYRS-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11ClO2
Molecular weight246.69 g/mol
IUPAC name3-(3-chloro-2-methylphenyl)benzoic acid
InChIKeyWATQOCAYEWBYRS-UHFFFAOYSA-N
SMILESCC1=C(C=CC=C1Cl)C2=CC(=CC=C2)C(=O)O

Computed by PubChem (NCBI)