Products 118169-17-8
CAS 118169-17-8 appears in our catalog under these names: Denthyrsinin, 3,7-Dihydroxy-2,4,8-trimethoxyphenanthrene, ≥98%. Offered by: MedChemExpress, Chemat. Available pack sizes: 5 mg, 10 mg, 1 mg, 5mg.
1,5,7-trimethoxyphenanthrene-2,6-diol (CAS 118169-17-8) is a chemical compound with the molecular formula C17H16O5 and a molecular weight of 300.30 g/mol. IUPAC name: 1,5,7-trimethoxyphenanthrene-2,6-diol. InChIKey: LLRLPRUFUGWYOL-UHFFFAOYSA-N.
| Molecular formula | C17H16O5 |
|---|---|
| Molecular weight | 300.30 g/mol |
| IUPAC name | 1,5,7-trimethoxyphenanthrene-2,6-diol |
| InChIKey | LLRLPRUFUGWYOL-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C2C(=C1)C=CC3=C2C=CC(=C3OC)O)OC)O |
Computed by PubChem (NCBI)