Products 1181691-33-7
CAS 1181691-33-7 is the registry number for 6-Bromo-7-methoxy-3,4-dihydroisoquinolin-1(2H)-one, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
6-bromo-7-methoxy-3,4-dihydro-2H-isoquinolin-1-one (CAS 1181691-33-7) is a chemical compound with the molecular formula C10H10BrNO2 and a molecular weight of 256.10 g/mol. IUPAC name: 6-bromo-7-methoxy-3,4-dihydro-2H-isoquinolin-1-one. InChIKey: YJLAKLXGNQIOIE-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO2 |
|---|---|
| Molecular weight | 256.10 g/mol |
| IUPAC name | 6-bromo-7-methoxy-3,4-dihydro-2H-isoquinolin-1-one |
| InChIKey | YJLAKLXGNQIOIE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2CCNC(=O)C2=C1)Br |
Computed by PubChem (NCBI)