Products 952915-21-8
CAS 952915-21-8 appears in our catalog under these names: 4-[Ethyl(ethylsulfonyl)amino]benzoic acid, 95%, 4-(EThyl(ethylsulfonyl)amino)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
4-[ethyl(ethylsulfonyl)amino]benzoic acid (CAS 952915-21-8) is a chemical compound with the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. IUPAC name: 4-[ethyl(ethylsulfonyl)amino]benzoic acid. InChIKey: VICCVJWRFZIBTE-UHFFFAOYSA-N.
| Molecular formula | C11H15NO4S |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | 4-[ethyl(ethylsulfonyl)amino]benzoic acid |
| InChIKey | VICCVJWRFZIBTE-UHFFFAOYSA-N |
| SMILES | CCN(C1=CC=C(C=C1)C(=O)O)S(=O)(=O)CC |
Computed by PubChem (NCBI)