CAS 1183430-59-2 appears in our catalog under these names: 2-(Furan-2-yl)thiazole-4-carbaldehyde, 98%, 2-(Furan-2-yl)-1,3-thiazole-4-carbaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-(furan-2-yl)-1,3-thiazole-4-carbaldehyde (CAS 1183430-59-2) is a chemical compound with the molecular formula C8H5NO2S and a molecular weight of 179.20 g/mol. IUPAC name: 2-(furan-2-yl)-1,3-thiazole-4-carbaldehyde. InChIKey: CICRHHYRKYJFCY-UHFFFAOYSA-N.
| Molecular formula | C8H5NO2S |
|---|---|
| Molecular weight | 179.20 g/mol |
| IUPAC name | 2-(furan-2-yl)-1,3-thiazole-4-carbaldehyde |
| InChIKey | CICRHHYRKYJFCY-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=NC(=CS2)C=O |
Computed by PubChem (NCBI)