CAS 1183687-49-1 is the registry number for 3-(3,5-Dimethylbenzoyl)pyridine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3,5-dimethylphenyl)-pyridin-3-ylmethanone (CAS 1183687-49-1) is a chemical compound with the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. IUPAC name: (3,5-dimethylphenyl)-pyridin-3-ylmethanone. InChIKey: BWPJGEGIXTWCQV-UHFFFAOYSA-N.
| Molecular formula | C14H13NO |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | (3,5-dimethylphenyl)-pyridin-3-ylmethanone |
| InChIKey | BWPJGEGIXTWCQV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(=O)C2=CN=CC=C2)C |
Computed by PubChem (NCBI)