Products 1183776-28-4
CAS 1183776-28-4 is the registry number for (5-Bromo-1-ethyl-1H-1,3-benzodiazol-2-yl)methanamine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(5-bromo-1-ethylbenzimidazol-2-yl)methanamine (CAS 1183776-28-4) is a chemical compound with the molecular formula C10H12BrN3 and a molecular weight of 254.13 g/mol. IUPAC name: (5-bromo-1-ethylbenzimidazol-2-yl)methanamine. InChIKey: VDQZWQIWJJVFRQ-UHFFFAOYSA-N.
| Molecular formula | C10H12BrN3 |
|---|---|
| Molecular weight | 254.13 g/mol |
| IUPAC name | (5-bromo-1-ethylbenzimidazol-2-yl)methanamine |
| InChIKey | VDQZWQIWJJVFRQ-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)Br)N=C1CN |
Computed by PubChem (NCBI)