CAS 1184003-44-8 appears in our catalog under these names: 3-(Pyrimidin-2-yl)-4,5-dihydro-1,2,4-oxadiazol-5-one, 95%, 3-(Pyrimidin-2-yl)-4,5-dihydro-1,2,4-oxadiazol-5-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-pyrimidin-2-yl-4H-1,2,4-oxadiazol-5-one (CAS 1184003-44-8) is a chemical compound with the molecular formula C6H4N4O2 and a molecular weight of 164.12 g/mol. IUPAC name: 3-pyrimidin-2-yl-4H-1,2,4-oxadiazol-5-one. InChIKey: NEMHIHAGDKMIKJ-UHFFFAOYSA-N.
| Molecular formula | C6H4N4O2 |
|---|---|
| Molecular weight | 164.12 g/mol |
| IUPAC name | 3-pyrimidin-2-yl-4H-1,2,4-oxadiazol-5-one |
| InChIKey | NEMHIHAGDKMIKJ-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1)C2=NOC(=O)N2 |
Computed by PubChem (NCBI)