Products 1184109-81-6
CAS 1184109-81-6 is the registry number for 2-Fluoro-5-(2-oxopyrrolidin-1-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 1000mg, 500mg.
2-fluoro-5-(2-oxopyrrolidin-1-yl)benzoic acid (CAS 1184109-81-6) is a chemical compound with the molecular formula C11H10FNO3 and a molecular weight of 223.20 g/mol. IUPAC name: 2-fluoro-5-(2-oxopyrrolidin-1-yl)benzoic acid. InChIKey: NKHUCLYOABFQOJ-UHFFFAOYSA-N.
| Molecular formula | C11H10FNO3 |
|---|---|
| Molecular weight | 223.20 g/mol |
| IUPAC name | 2-fluoro-5-(2-oxopyrrolidin-1-yl)benzoic acid |
| InChIKey | NKHUCLYOABFQOJ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1)C2=CC(=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)