CAS 1184224-97-2 appears in our catalog under these names: 3-Methyl-1-(3-(trifluoromethyl)phenyl)butan-1-one, 95%, 3-Methyl-1-(3-(trifluoromethyl)phenyl)butan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
3-methyl-1-[3-(trifluoromethyl)phenyl]butan-1-one (CAS 1184224-97-2) is a chemical compound with the molecular formula C12H13F3O and a molecular weight of 230.23 g/mol. IUPAC name: 3-methyl-1-[3-(trifluoromethyl)phenyl]butan-1-one. InChIKey: BNJMKJLTHQZXOJ-UHFFFAOYSA-N.
| Molecular formula | C12H13F3O |
|---|---|
| Molecular weight | 230.23 g/mol |
| IUPAC name | 3-methyl-1-[3-(trifluoromethyl)phenyl]butan-1-one |
| InChIKey | BNJMKJLTHQZXOJ-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)C1=CC(=CC=C1)C(F)(F)F |
Computed by PubChem (NCBI)