CAS 1595844-36-2 is the registry number for α-Cyclopropyl-2-methyl-4-(trifluoromethyl)benzenemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Cyclopropyl-[2-methyl-4-(trifluoromethyl)phenyl]methanol (CAS 1595844-36-2) is a chemical compound with the molecular formula C12H13F3O and a molecular weight of 230.23 g/mol. IUPAC name: cyclopropyl-[2-methyl-4-(trifluoromethyl)phenyl]methanol. InChIKey: CNSUVYDYCSSRIA-UHFFFAOYSA-N.
| Molecular formula | C12H13F3O |
|---|---|
| Molecular weight | 230.23 g/mol |
| IUPAC name | cyclopropyl-[2-methyl-4-(trifluoromethyl)phenyl]methanol |
| InChIKey | CNSUVYDYCSSRIA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(F)(F)F)C(C2CC2)O |
Computed by PubChem (NCBI)