Products 1365271-30-2
CAS 1365271-30-2 is the registry number for 1-Cyclopentyloxy-3-(trifluoromethyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
1-cyclopentyloxy-3-(trifluoromethyl)benzene (CAS 1365271-30-2) is a chemical compound with the molecular formula C12H13F3O and a molecular weight of 230.23 g/mol. IUPAC name: 1-cyclopentyloxy-3-(trifluoromethyl)benzene. InChIKey: XVSVZOCDZOLUSY-UHFFFAOYSA-N.
| Molecular formula | C12H13F3O |
|---|---|
| Molecular weight | 230.23 g/mol |
| IUPAC name | 1-cyclopentyloxy-3-(trifluoromethyl)benzene |
| InChIKey | XVSVZOCDZOLUSY-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)OC2=CC=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)