CAS 73471-97-3 appears in our catalog under these names: 4'-tert-Butyl-2,2,2-trifluoroacetophenone, 97%, 1-(4-(tert-Butyl)phenyl)-2,2,2-trifluoroethanone 98%, 4'-tert-Butyl-2,2,2-trifluoroacetophenone, 98%, 98%. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg.
1-(4-tert-butylphenyl)-2,2,2-trifluoroethanone (CAS 73471-97-3) is a chemical compound with the molecular formula C12H13F3O and a molecular weight of 230.23 g/mol. IUPAC name: 1-(4-tert-butylphenyl)-2,2,2-trifluoroethanone. InChIKey: JGHXRQPPRZMKDB-UHFFFAOYSA-N.
| Molecular formula | C12H13F3O |
|---|---|
| Molecular weight | 230.23 g/mol |
| IUPAC name | 1-(4-tert-butylphenyl)-2,2,2-trifluoroethanone |
| InChIKey | JGHXRQPPRZMKDB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)