Products 2901950-00-1
CAS 2901950-00-1 is the registry number for (7-(Trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-2-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[7-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]methanol (CAS 2901950-00-1) is a chemical compound with the molecular formula C12H13F3O and a molecular weight of 230.23 g/mol. IUPAC name: [7-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]methanol. InChIKey: RQYCBUYNVOMTET-UHFFFAOYSA-N.
| Molecular formula | C12H13F3O |
|---|---|
| Molecular weight | 230.23 g/mol |
| IUPAC name | [7-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]methanol |
| InChIKey | RQYCBUYNVOMTET-UHFFFAOYSA-N |
| SMILES | C1CC2=C(CC1CO)C=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)