Products 1184262-80-3
CAS 1184262-80-3 is the registry number for 1-(1,3-Dioxaindan-5-yl)-2-(4-methoxyphenyl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)ethanone (CAS 1184262-80-3) is a chemical compound with the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)ethanone. InChIKey: GUOGPUXNMRBFJU-UHFFFAOYSA-N.
| Molecular formula | C16H14O4 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)ethanone |
| InChIKey | GUOGPUXNMRBFJU-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CC(=O)C2=CC3=C(C=C2)OCO3 |
Computed by PubChem (NCBI)