CAS 1184394-61-3 is the registry number for 1-(3,4-Difluorophenyl)-2-methylpropan-1-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(3,4-difluorophenyl)-2-methylpropan-1-ol (CAS 1184394-61-3) is a chemical compound with the molecular formula C10H12F2O and a molecular weight of 186.20 g/mol. IUPAC name: 1-(3,4-difluorophenyl)-2-methylpropan-1-ol. InChIKey: KNYXACFXBRIOGI-UHFFFAOYSA-N.
| Molecular formula | C10H12F2O |
|---|---|
| Molecular weight | 186.20 g/mol |
| IUPAC name | 1-(3,4-difluorophenyl)-2-methylpropan-1-ol |
| InChIKey | KNYXACFXBRIOGI-UHFFFAOYSA-N |
| SMILES | CC(C)C(C1=CC(=C(C=C1)F)F)O |
Computed by PubChem (NCBI)