Products 1184452-50-3
CAS 1184452-50-3 appears in our catalog under these names: 4-Fluoro-3-methanesulfonamidobenzoic acid, 4-Fluoro-3-methanesulfonamidobenzoic acid, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 5g, 10g, 250mg.
4-fluoro-3-(methanesulfonamido)benzoic acid (CAS 1184452-50-3) is a chemical compound with the molecular formula C8H8FNO4S and a molecular weight of 233.22 g/mol. IUPAC name: 4-fluoro-3-(methanesulfonamido)benzoic acid. InChIKey: CPRDLCOJNODCAS-UHFFFAOYSA-N.
| Molecular formula | C8H8FNO4S |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 4-fluoro-3-(methanesulfonamido)benzoic acid |
| InChIKey | CPRDLCOJNODCAS-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=C(C=CC(=C1)C(=O)O)F |
Computed by PubChem (NCBI)