Products 926196-72-7
CAS 926196-72-7 appears in our catalog under these names: 4-Fluoro-3-(methylsulfamoyl)benzoic acid, 95%, 4-Fluoro-3-(methylsulfamoyl)benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 250mg, 5g, 0,5g.
4-fluoro-3-(methylsulfamoyl)benzoic acid (CAS 926196-72-7) is a chemical compound with the molecular formula C8H8FNO4S and a molecular weight of 233.22 g/mol. IUPAC name: 4-fluoro-3-(methylsulfamoyl)benzoic acid. InChIKey: NAUQCMNLXQNWRK-UHFFFAOYSA-N.
| Molecular formula | C8H8FNO4S |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 4-fluoro-3-(methylsulfamoyl)benzoic acid |
| InChIKey | NAUQCMNLXQNWRK-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=C(C=CC(=C1)C(=O)O)F |
Computed by PubChem (NCBI)