Products 170107-84-3
CAS 170107-84-3 appears in our catalog under these names: 4-Fluoro-2-methanesulfonamidobenzoic acid, 95%, 4-Fluoro-2-(methylsulfonamido)benzoic acid, 95+%, 4-Fluoro-2-methanesulfonamidobenzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
4-fluoro-2-(methanesulfonamido)benzoic acid (CAS 170107-84-3) is a chemical compound with the molecular formula C8H8FNO4S and a molecular weight of 233.22 g/mol. IUPAC name: 4-fluoro-2-(methanesulfonamido)benzoic acid. InChIKey: TZGMSNABOSDFNW-UHFFFAOYSA-N.
| Molecular formula | C8H8FNO4S |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 4-fluoro-2-(methanesulfonamido)benzoic acid |
| InChIKey | TZGMSNABOSDFNW-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=C(C=CC(=C1)F)C(=O)O |
Computed by PubChem (NCBI)