CAS 137315-01-6 appears in our catalog under these names: 2-Fluoro-5-(methylsulfonamido)benzoic acid 97%, 2-Fluoro-5-(methylsulfonamido)benzoic acid, 97%, 97%, 2-FLUORO-5-(METHYLSULFONAMIDO)BENZOIC ACID, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g.
2-fluoro-5-(methanesulfonamido)benzoic acid (CAS 137315-01-6) is a chemical compound with the molecular formula C8H8FNO4S and a molecular weight of 233.22 g/mol. IUPAC name: 2-fluoro-5-(methanesulfonamido)benzoic acid. InChIKey: DCNPDTTWNSWIJA-UHFFFAOYSA-N.
| Molecular formula | C8H8FNO4S |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 2-fluoro-5-(methanesulfonamido)benzoic acid |
| InChIKey | DCNPDTTWNSWIJA-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=CC(=C(C=C1)F)C(=O)O |
Computed by PubChem (NCBI)