Products 716361-59-0
CAS 716361-59-0 appears in our catalog under these names: 3-Fluoro-4-(methylsulfonamido)benzoic acid, 95%, 3–Fluoro–4–(methylsulfonamido)benzoic Acid, 3-Fluoro-4-(methylsulfonamido)benzoic Acid, 98%, 98%, 3-Fluoro-4-(methylsulfonamido)benzoic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
3-fluoro-4-(methanesulfonamido)benzoic acid (CAS 716361-59-0) is a chemical compound with the molecular formula C8H8FNO4S and a molecular weight of 233.22 g/mol. IUPAC name: 3-fluoro-4-(methanesulfonamido)benzoic acid. InChIKey: BYIDDQNOFZGHAR-UHFFFAOYSA-N.
| Molecular formula | C8H8FNO4S |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 3-fluoro-4-(methanesulfonamido)benzoic acid |
| InChIKey | BYIDDQNOFZGHAR-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=C(C=C(C=C1)C(=O)O)F |
Computed by PubChem (NCBI)