Products 1184453-80-2
CAS 1184453-80-2 is the registry number for N-Benzyl-4-bromo-N-(2-hydroxyethyl)-1H-pyrrole-2-carboxamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N-benzyl-4-bromo-N-(2-hydroxyethyl)-1H-pyrrole-2-carboxamide (CAS 1184453-80-2) is a chemical compound with the molecular formula C14H15BrN2O2 and a molecular weight of 323.18 g/mol. IUPAC name: N-benzyl-4-bromo-N-(2-hydroxyethyl)-1H-pyrrole-2-carboxamide. InChIKey: DGYGMMITYVLTLF-UHFFFAOYSA-N.
| Molecular formula | C14H15BrN2O2 |
|---|---|
| Molecular weight | 323.18 g/mol |
| IUPAC name | N-benzyl-4-bromo-N-(2-hydroxyethyl)-1H-pyrrole-2-carboxamide |
| InChIKey | DGYGMMITYVLTLF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN(CCO)C(=O)C2=CC(=CN2)Br |
Computed by PubChem (NCBI)