CAS 1184524-48-8 is the registry number for 3-((4-Chlorophenyl)sulfanyl)aniline, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-(4-chlorophenyl)sulfanylaniline (CAS 1184524-48-8) is a chemical compound with the molecular formula C12H10ClNS and a molecular weight of 235.73 g/mol. IUPAC name: 3-(4-chlorophenyl)sulfanylaniline. InChIKey: BPPXVZXOUSFCSI-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNS |
|---|---|
| Molecular weight | 235.73 g/mol |
| IUPAC name | 3-(4-chlorophenyl)sulfanylaniline |
| InChIKey | BPPXVZXOUSFCSI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)SC2=CC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)