CAS 32631-26-8 appears in our catalog under these names: 3-Chloro-4-(phenylsulfanyl)aniline, 95%, 3-Chloro-4-(phenylsulfanyl)aniline. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
3-chloro-4-phenylsulfanylaniline (CAS 32631-26-8) is a chemical compound with the molecular formula C12H10ClNS and a molecular weight of 235.73 g/mol. IUPAC name: 3-chloro-4-phenylsulfanylaniline. InChIKey: CKRNYBQUMRCICU-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNS |
|---|---|
| Molecular weight | 235.73 g/mol |
| IUPAC name | 3-chloro-4-phenylsulfanylaniline |
| InChIKey | CKRNYBQUMRCICU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SC2=C(C=C(C=C2)N)Cl |
Computed by PubChem (NCBI)