CAS 1427562-69-3 is the registry number for 5-Chloro-2-[(phenylmethyl)thio]pyridine. Offered by: Chemat. Available pack sizes: 100mg.
2-benzylsulfanyl-5-chloropyridine (CAS 1427562-69-3) is a chemical compound with the molecular formula C12H10ClNS and a molecular weight of 235.73 g/mol. IUPAC name: 2-benzylsulfanyl-5-chloropyridine. InChIKey: XFCRKJZILQVXJT-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNS |
|---|---|
| Molecular weight | 235.73 g/mol |
| IUPAC name | 2-benzylsulfanyl-5-chloropyridine |
| InChIKey | XFCRKJZILQVXJT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=NC=C(C=C2)Cl |
Computed by PubChem (NCBI)