CAS 71506-79-1 appears in our catalog under these names: 4-(Benzylsulfanyl)-2-chloropyridine, 95%, 4-(Benzylsulfanyl)-2-chloropyridine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
4-benzylsulfanyl-2-chloropyridine (CAS 71506-79-1) is a chemical compound with the molecular formula C12H10ClNS and a molecular weight of 235.73 g/mol. IUPAC name: 4-benzylsulfanyl-2-chloropyridine. InChIKey: GDFNNSRGEYSAOZ-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNS |
|---|---|
| Molecular weight | 235.73 g/mol |
| IUPAC name | 4-benzylsulfanyl-2-chloropyridine |
| InChIKey | GDFNNSRGEYSAOZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=CC(=NC=C2)Cl |
Computed by PubChem (NCBI)