CAS 71554-63-7 appears in our catalog under these names: 5-(Benzylthio)-2-chloropyridine, 95%, 5–(Benzylthio)–2–chloropyridine. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 100mg, 250mg, 5g.
5-benzylsulfanyl-2-chloropyridine (CAS 71554-63-7) is a chemical compound with the molecular formula C12H10ClNS and a molecular weight of 235.73 g/mol. IUPAC name: 5-benzylsulfanyl-2-chloropyridine. InChIKey: XEVPYLMWONPKTE-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNS |
|---|---|
| Molecular weight | 235.73 g/mol |
| IUPAC name | 5-benzylsulfanyl-2-chloropyridine |
| InChIKey | XEVPYLMWONPKTE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=CN=C(C=C2)Cl |
Computed by PubChem (NCBI)