CAS 1184653-06-2 appears in our catalog under these names: 3-(1,3-Thiazol-4-ylmethoxy)aniline, 95%, 3-(1,3-Thiazol-4-ylmethoxy)aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-(1,3-thiazol-4-ylmethoxy)aniline (CAS 1184653-06-2) is a chemical compound with the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. IUPAC name: 3-(1,3-thiazol-4-ylmethoxy)aniline. InChIKey: IVIGYIAJQZNTTG-UHFFFAOYSA-N.
| Molecular formula | C10H10N2OS |
|---|---|
| Molecular weight | 206.27 g/mol |
| IUPAC name | 3-(1,3-thiazol-4-ylmethoxy)aniline |
| InChIKey | IVIGYIAJQZNTTG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC2=CSC=N2)N |
Computed by PubChem (NCBI)