Products 1184753-48-7
CAS 1184753-48-7 is the registry number for 1-(5-Bromo-1,3-thiazol-2-yl)piperidine-2,6-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(5-bromo-1,3-thiazol-2-yl)piperidine-2,6-dione (CAS 1184753-48-7) is a chemical compound with the molecular formula C8H7BrN2O2S and a molecular weight of 275.12 g/mol. IUPAC name: 1-(5-bromo-1,3-thiazol-2-yl)piperidine-2,6-dione. InChIKey: DLWYVDALXIHYKQ-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O2S |
|---|---|
| Molecular weight | 275.12 g/mol |
| IUPAC name | 1-(5-bromo-1,3-thiazol-2-yl)piperidine-2,6-dione |
| InChIKey | DLWYVDALXIHYKQ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C(=O)C1)C2=NC=C(S2)Br |
Computed by PubChem (NCBI)