CAS 1185022-87-0 appears in our catalog under these names: C-(6-Trifluoromethyl-pyridin-2-yl)methylamine hydrochloride, 95%, 6-(Trifluoromethyl)pyridine-2-methylamine hydrochloride 95%, 6-(Trifluoromethyl)pyridine-2-methylamine hydrochloride, 95%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
[6-(trifluoromethyl)-2-pyridinyl]methanamine;hydrochloride (CAS 1185022-87-0) is a chemical compound with the molecular formula C7H8ClF3N2 and a molecular weight of 212.60 g/mol. IUPAC name: [6-(trifluoromethyl)-2-pyridinyl]methanamine;hydrochloride. InChIKey: AOKKQPXZPSPBEZ-UHFFFAOYSA-N.
| Molecular formula | C7H8ClF3N2 |
|---|---|
| Molecular weight | 212.60 g/mol |
| IUPAC name | [6-(trifluoromethyl)-2-pyridinyl]methanamine;hydrochloride |
| InChIKey | AOKKQPXZPSPBEZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)C(F)(F)F)CN.Cl |
Computed by PubChem (NCBI)