CAS 1187932-68-8 appears in our catalog under these names: (3–(trifluoromethyl)pyridin–2–yl)methanamine hydrochloride, (3-(Trifluoromethyl)pyridin-2-yl)methanamine hydrochloride 95%, (3-(Trifluoromethyl)pyridin-2-yl)methanamine hydrochloride, 95%, 95%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.
[3-(trifluoromethyl)-2-pyridinyl]methanamine;hydrochloride (CAS 1187932-68-8) is a chemical compound with the molecular formula C7H8ClF3N2 and a molecular weight of 212.60 g/mol. IUPAC name: [3-(trifluoromethyl)-2-pyridinyl]methanamine;hydrochloride. InChIKey: YWIVAUJFAGZFTR-UHFFFAOYSA-N.
| Molecular formula | C7H8ClF3N2 |
|---|---|
| Molecular weight | 212.60 g/mol |
| IUPAC name | [3-(trifluoromethyl)-2-pyridinyl]methanamine;hydrochloride |
| InChIKey | YWIVAUJFAGZFTR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)CN)C(F)(F)F.Cl |
Computed by PubChem (NCBI)