CAS 3107-33-3 appears in our catalog under these names: 3-Trifluoromethylphenylhydrazine Hydrochloride, 3–(Trifluoromethyl)phenylhydrazine hydrochloride, 3-Trifluoromethyl phenylhydrazine hydrochloride, 3-(Trifluoromethyl)phenylhydrazine hydrochloride, 90%, (3-(Trifluoromethyl)phenyl)hydrazine hydrochloride 95%. Offered by: TRC, GLPBio, Biosynth, Fluorochem, Ambeed. Available pack sizes: 10g, 25g, 5g, 100g, 1g, 500g.
[3-(trifluoromethyl)phenyl]hydrazine;hydrochloride (CAS 3107-33-3) is a chemical compound with the molecular formula C7H8ClF3N2 and a molecular weight of 212.60 g/mol. IUPAC name: [3-(trifluoromethyl)phenyl]hydrazine;hydrochloride. InChIKey: XVVBLYYGZHLQDX-UHFFFAOYSA-N.
| Molecular formula | C7H8ClF3N2 |
|---|---|
| Molecular weight | 212.60 g/mol |
| IUPAC name | [3-(trifluoromethyl)phenyl]hydrazine;hydrochloride |
| InChIKey | XVVBLYYGZHLQDX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NN)C(F)(F)F.Cl |
Computed by PubChem (NCBI)