Products 1187929-38-9

CAS 1187929-38-9 is the registry number for 2,2,2-Trifluoro-1-(pyridin-2-yl)ethanamine hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 10g, 1g, 100mg.

Structural formula: {0} (CAS {1})

2,2,2-trifluoro-1-pyridin-2-ylethanamine;hydrochloride (CAS 1187929-38-9) is a chemical compound with the molecular formula C7H8ClF3N2 and a molecular weight of 212.60 g/mol. IUPAC name: 2,2,2-trifluoro-1-pyridin-2-ylethanamine;hydrochloride. InChIKey: CQZMNGPRQBZYSO-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8ClF3N2
Molecular weight212.60 g/mol
IUPAC name2,2,2-trifluoro-1-pyridin-2-ylethanamine;hydrochloride
InChIKeyCQZMNGPRQBZYSO-UHFFFAOYSA-N
SMILESC1=CC=NC(=C1)C(C(F)(F)F)N.Cl

Computed by PubChem (NCBI)