CAS 2923-56-0 appears in our catalog under these names: 1–(4–(Trifluoromethyl)phenyl)hydrazine hydrochloride, 4-(Trifluoromethyl)phenylhydrazine hydrochloride, 96% , 4-Trifluoromethylphenyl hydrazine hydrochloride, (4-(Trifluoromethyl)phenyl)hydrazine hydrochloride 97%, 4-(Trifluoromethyl)phenylhydrazine hydrochloride, 98%, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Ambeed, Chemat. Available pack sizes: 100g, 25g, 1g, 10g, 50g, 250g, 5g, 500g.
[4-(trifluoromethyl)phenyl]hydrazine;hydrochloride (CAS 2923-56-0) is a chemical compound with the molecular formula C7H8ClF3N2 and a molecular weight of 212.60 g/mol. IUPAC name: [4-(trifluoromethyl)phenyl]hydrazine;hydrochloride. InChIKey: WCAGNYIHAYOPSE-UHFFFAOYSA-N.
| Molecular formula | C7H8ClF3N2 |
|---|---|
| Molecular weight | 212.60 g/mol |
| IUPAC name | [4-(trifluoromethyl)phenyl]hydrazine;hydrochloride |
| InChIKey | WCAGNYIHAYOPSE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)NN.Cl |
Computed by PubChem (NCBI)